C15H21F6IN4O — CID 111599059
1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111599059) has the molecular formula C15H21F6IN4O and a molecular weight of 514.25 g/mol. Its IUPAC name is 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111599059 |
| Molecular Formula | C15H21F6IN4O |
| Molecular Weight | 514.25 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-[[4-(trifluoromethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CN(CCCN/C(N)=N/Cc1ccc(OC(F)(F)F)cc1)CC(F)(F)F.I |
| InChI | InChI=1S/C15H20F6N4O.HI/c1-25(10-14(16,17)18)8-2-7-23-13(22)24-9-11-3-5-12(6-4-11)26-15(19,20)21;/h3-6H,2,7-10H2,1H3,(H3,22,23,24);1H |
| InChIKey | ZGNPOJRLNXUOLN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|