C17H24F3IN4O2 — CID 111599505
N-cyclopentyl-3-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111599505) has the molecular formula C17H24F3IN4O2 and a molecular weight of 500.30 g/mol. Its IUPAC name is N-cyclopentyl-3-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-cyclopentyl-3-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111599505 |
| Molecular Formula | C17H24F3IN4O2 |
| Molecular Weight | 500.30 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | N-cyclopentyl-3-[[N'-[[4-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(OC(F)(F)F)cc1)NCCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H23F3N4O2.HI/c18-17(19,20)26-14-7-5-12(6-8-14)11-23-16(21)22-10-9-15(25)24-13-3-1-2-4-13;/h5-8,13H,1-4,9-11H2,(H,24,25)(H3,21,22,23);1H |
| InChIKey | WRQVRXSBXOOUNW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|