C19H32FIN4O2 — CID 111773779
tert-butyl N-[1-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide (PubChem CID 111773779) has the molecular formula C19H32FIN4O2 and a molecular weight of 494.39 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111773779 |
| Molecular Formula | C19H32FIN4O2 |
| Molecular Weight | 494.39 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCC(C)(C)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H31FN4O2.HI/c1-7-21-16(22-12-14-8-10-15(20)11-9-14)23-13-19(5,6)24-17(25)26-18(2,3)4;/h8-11H,7,12-13H2,1-6H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | XSJINTDFPZROEH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|