C20H35IN4O3 — CID 111773523
tert-butyl N-[1-[[N-ethyl-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide (PubChem CID 111773523) has the molecular formula C20H35IN4O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is tert-butyl N-[1-[[N-ethyl-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[1-[[N-ethyl-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111773523 |
| Molecular Formula | C20H35IN4O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | tert-butyl N-[1-[[N-ethyl-N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]-2-methylpropan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1OC)NCC(C)(C)NC(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C20H34N4O3.HI/c1-8-21-17(22-13-15-11-9-10-12-16(15)26-7)23-14-20(5,6)24-18(25)27-19(2,3)4;/h9-12H,8,13-14H2,1-7H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | NRCXVJBXHRHOKY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|