C16H28N4O3S — CID 111782578
1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(2-methoxyphenyl)methyl]guanidine (PubChem CID 111782578) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(2-methoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(2-methoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111782578 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[(2-methoxyphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OC)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C16H28N4O3S/c1-6-17-15(19-12-16(2,3)20-24(5,21)22)18-11-13-9-7-8-10-14(13)23-4/h7-10,20H,6,11-12H2,1-5H3,(H2,17,18,19) |
| InChIKey | HRSQUJVOAMZJMD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|