C16H25F3N4O2S — CID 111787741
1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111787741) has the molecular formula C16H25F3N4O2S and a molecular weight of 394.46 g/mol. Its IUPAC name is 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111787741 |
| Molecular Formula | C16H25F3N4O2S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-ethyl-3-[2-(methanesulfonamido)-2-methylpropyl]-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCC(C)(C)NS(C)(=O)=O |
| InChI | InChI=1S/C16H25F3N4O2S/c1-5-20-14(22-11-15(2,3)23-26(4,24)25)21-10-12-6-8-13(9-7-12)16(17,18)19/h6-9,23H,5,10-11H2,1-4H3,(H2,20,21,22) |
| InChIKey | JXIUOMZPJQBIMF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|