C18H27F3N4O — CID 111420471
N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111420471) has the molecular formula C18H27F3N4O and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111420471 |
| Molecular Formula | C18H27F3N4O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27F3N4O/c1-5-22-16(24-11-10-23-15(26)17(2,3)4)25-12-13-6-8-14(9-7-13)18(19,20)21/h6-9H,5,10-12H2,1-4H3,(H,23,26)(H2,22,24,25) |
| InChIKey | CKSHPVSWCYXIBT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|