C19H24F3IN4O2S — CID 111420310
1-[2-(benzenesulfonamido)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111420310) has the molecular formula C19H24F3IN4O2S and a molecular weight of 556.39 g/mol. Its IUPAC name is 1-[2-(benzenesulfonamido)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonamido)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111420310 |
| Molecular Formula | C19H24F3IN4O2S |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 556.06 |
| IUPAC Name | 1-[2-(benzenesulfonamido)ethyl]-3-ethyl-2-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(F)(F)F)cc1)NCCNS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C19H23F3N4O2S.HI/c1-2-23-18(25-14-15-8-10-16(11-9-15)19(20,21)22)24-12-13-26-29(27,28)17-6-4-3-5-7-17;/h3-11,26H,2,12-14H2,1H3,(H2,23,24,25);1H |
| InChIKey | BMJSKIWWGVRSBQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|