C19H23F3N4O2S — CID 111295349
1-ethyl-2-[(3-sulfamoylphenyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine (PubChem CID 111295349) has the molecular formula C19H23F3N4O2S and a molecular weight of 428.48 g/mol. Its IUPAC name is 1-ethyl-2-[(3-sulfamoylphenyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-sulfamoylphenyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
|---|---|
| PubChem CID | 111295349 |
| Molecular Formula | C19H23F3N4O2S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 1-ethyl-2-[(3-sulfamoylphenyl)methyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H23F3N4O2S/c1-2-24-18(26-13-15-4-3-5-17(12-15)29(23,27)28)25-11-10-14-6-8-16(9-7-14)19(20,21)22/h3-9,12H,2,10-11,13H2,1H3,(H2,23,27,28)(H2,24,25,26) |
| InChIKey | UWMWCJNTSBBSEM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|