C21H26N6O2S — CID 111864458
1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(3-sulfamoylphenyl)methyl]guanidine (PubChem CID 111864458) has the molecular formula C21H26N6O2S and a molecular weight of 426.55 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(3-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(3-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111864458 |
| Molecular Formula | C21H26N6O2S |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-ethyl-3-[2-(4-pyrazol-1-ylphenyl)ethyl]-2-[(3-sulfamoylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(S(N)(=O)=O)c1)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C21H26N6O2S/c1-2-23-21(25-16-18-5-3-6-20(15-18)30(22,28)29)24-13-11-17-7-9-19(10-8-17)27-14-4-12-26-27/h3-10,12,14-15H,2,11,13,16H2,1H3,(H2,22,28,29)(H2,23,24,25) |
| InChIKey | LIPKOGICCWCVJG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|