C17H28FIN4O — CID 111231884
N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 111231884) has the molecular formula C17H28FIN4O and a molecular weight of 450.34 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111231884 |
| Molecular Formula | C17H28FIN4O |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[(4-fluorophenyl)methyl]carbamimidoyl]amino]ethyl]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1)NCCNC(=O)C(C)(C)C.I |
| InChI | InChI=1S/C17H27FN4O.HI/c1-5-19-16(21-11-10-20-15(23)17(2,3)4)22-12-13-6-8-14(18)9-7-13;/h6-9H,5,10-12H2,1-4H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | GNOKVKQHGBUMAQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|