C63H66O12 — CID 101465913
[4-[1-[3,5-bis[1-(4-hydroxyphenyl)-1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] tert-butyl carbonate (PubChem CID 101465913) has the molecular formula C63H66O12 and a molecular weight of 1015.21 g/mol. Its IUPAC name is [4-[1-[3,5-bis[1-(4-hydroxyphenyl)-1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] tert-butyl carbonate.
| Compound Name | [4-[1-[3,5-bis[1-(4-hydroxyphenyl)-1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 101465913 |
| Molecular Formula | C63H66O12 |
| Molecular Weight | 1015.21 g/mol |
| Exact Mass | 1014.46 |
| IUPAC Name | [4-[1-[3,5-bis[1-(4-hydroxyphenyl)-1-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl]phenyl]-1-(4-hydroxyphenyl)ethyl]phenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(C(C)(c2ccc(O)cc2)c2cc(C(C)(c3ccc(O)cc3)c3ccc(OC(=O)OC(C)(C)C)cc3)cc(C(C)(c3ccc(O)cc3)c3ccc(OC(=O)OC(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C63H66O12/c1-58(2,3)73-55(67)70-52-31-19-43(20-32-52)61(10,40-13-25-49(64)26-14-40)46-37-47(62(11,41-15-27-50(65)28-16-41)44-21-33-53(34-22-44)71-56(68)74-59(4,5)6)39-48(38-46)63(12,42-17-29-51(66)30-18-42)45-23-35-54(36-24-45)72-57(69)75-60(7,8)9/h13-39,64-66H,1-12H3 |
| InChIKey | FZJXOSCDCGSZGG-UHFFFAOYSA-N |
| XLogP | 14.81 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.21 |
| LogP ≤ 5 | 14.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|