C38H40O9 — CID 21360353
[4-[2-[4-[1,1-bis(4-methoxycarbonyloxyphenyl)ethyl]phenyl]propan-2-yl]phenyl] tert-butyl carbonate (PubChem CID 21360353) has the molecular formula C38H40O9 and a molecular weight of 640.73 g/mol. Its IUPAC name is [4-[2-[4-[1,1-bis(4-methoxycarbonyloxyphenyl)ethyl]phenyl]propan-2-yl]phenyl] tert-butyl carbonate.
| Compound Name | [4-[2-[4-[1,1-bis(4-methoxycarbonyloxyphenyl)ethyl]phenyl]propan-2-yl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 21360353 |
| Molecular Formula | C38H40O9 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [4-[2-[4-[1,1-bis(4-methoxycarbonyloxyphenyl)ethyl]phenyl]propan-2-yl]phenyl] tert-butyl carbonate |
| SMILES | COC(=O)Oc1ccc(C(C)(c2ccc(OC(=O)OC)cc2)c2ccc(C(C)(C)c3ccc(OC(=O)OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H40O9/c1-36(2,3)47-35(41)46-32-19-13-26(14-20-32)37(4,5)25-9-11-27(12-10-25)38(6,28-15-21-30(22-16-28)44-33(39)42-7)29-17-23-31(24-18-29)45-34(40)43-8/h9-24H,1-8H3 |
| InChIKey | GRHQKVZDTYPOEV-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|