C29H38O6 — CID 142062661
2-(3,4-dimethylcyclohexyl)propan-2-yl [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] carbonate (PubChem CID 142062661) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-(3,4-dimethylcyclohexyl)propan-2-yl [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] carbonate.
| Compound Name | 2-(3,4-dimethylcyclohexyl)propan-2-yl [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] carbonate |
|---|---|
| PubChem CID | 142062661 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | 2-(3,4-dimethylcyclohexyl)propan-2-yl [4-[2-(4-methoxycarbonyloxyphenyl)propan-2-yl]phenyl] carbonate |
| SMILES | COC(=O)Oc1ccc(C(C)(C)c2ccc(OC(=O)OC(C)(C)C3CCC(C)C(C)C3)cc2)cc1 |
| InChI | InChI=1S/C29H38O6/c1-19-8-9-23(18-20(19)2)29(5,6)35-27(31)34-25-16-12-22(13-17-25)28(3,4)21-10-14-24(15-11-21)33-26(30)32-7/h10-17,19-20,23H,8-9,18H2,1-7H3 |
| InChIKey | MROUOZNGMQNYKX-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|