C33H42O4 — CID 126546369
[4-[2-(4-tert-butylphenyl)propan-2-yl]phenyl] 2-(2-methoxy-4-propan-2-ylphenyl)propan-2-yl carbonate (PubChem CID 126546369) has the molecular formula C33H42O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is [4-[2-(4-tert-butylphenyl)propan-2-yl]phenyl] 2-(2-methoxy-4-propan-2-ylphenyl)propan-2-yl carbonate.
| Compound Name | [4-[2-(4-tert-butylphenyl)propan-2-yl]phenyl] 2-(2-methoxy-4-propan-2-ylphenyl)propan-2-yl carbonate |
|---|---|
| PubChem CID | 126546369 |
| Molecular Formula | C33H42O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | [4-[2-(4-tert-butylphenyl)propan-2-yl]phenyl] 2-(2-methoxy-4-propan-2-ylphenyl)propan-2-yl carbonate |
| SMILES | COc1cc(C(C)C)ccc1C(C)(C)OC(=O)Oc1ccc(C(C)(C)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H42O4/c1-22(2)23-11-20-28(29(21-23)35-10)33(8,9)37-30(34)36-27-18-16-26(17-19-27)32(6,7)25-14-12-24(13-15-25)31(3,4)5/h11-22H,1-10H3 |
| InChIKey | IWJZDCPPGFBXMT-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|