C12H18BN3O2 — CID 177154667
CID 177154667 (PubChem CID 177154667) has the molecular formula C12H18BN3O2 and a molecular weight of 247.11 g/mol.
| Compound Name | CID 177154667 |
|---|---|
| PubChem CID | 177154667 |
| Molecular Formula | C12H18BN3O2 |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(C(C)(C)NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C12H18BN3O2/c1-11(2,3)18-10(17)16-12(4,5)9-14-6-8(13)7-15-9/h6-7H,1-5H3,(H,16,17) |
| InChIKey | ZPOVRMRYYAIEPJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|