C13H21N3O2 — CID 167211985
tert-butyl N-[2-(4-amino-2-pyridinyl)propan-2-yl]carbamate (PubChem CID 167211985) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl N-[2-(4-amino-2-pyridinyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(4-amino-2-pyridinyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 167211985 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | tert-butyl N-[2-(4-amino-2-pyridinyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1cc(N)ccn1 |
| InChI | InChI=1S/C13H21N3O2/c1-12(2,3)18-11(17)16-13(4,5)10-8-9(14)6-7-15-10/h6-8H,1-5H3,(H2,14,15)(H,16,17) |
| InChIKey | PXUYFOYPBZEDAL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |