C18H21ClN4O4 — CID 139271472
tert-butyl N-[2-[5-(3-chloro-5-nitro-2-pyridinyl)-2-pyridinyl]propan-2-yl]carbamate (PubChem CID 139271472) has the molecular formula C18H21ClN4O4 and a molecular weight of 392.84 g/mol. Its IUPAC name is tert-butyl N-[2-[5-(3-chloro-5-nitro-2-pyridinyl)-2-pyridinyl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-[5-(3-chloro-5-nitro-2-pyridinyl)-2-pyridinyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 139271472 |
| Molecular Formula | C18H21ClN4O4 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | tert-butyl N-[2-[5-(3-chloro-5-nitro-2-pyridinyl)-2-pyridinyl]propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C)(C)c1ccc(-c2ncc([N+](=O)[O-])cc2Cl)cn1 |
| InChI | InChI=1S/C18H21ClN4O4/c1-17(2,3)27-16(24)22-18(4,5)14-7-6-11(9-20-14)15-13(19)8-12(10-21-15)23(25)26/h6-10H,1-5H3,(H,22,24) |
| InChIKey | OCRGOAQHGJAHGU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|