C16H16ClN3O5 — CID 175583227
tert-butyl N-[4-(2-chloro-4-nitrophenoxy)-2-pyridinyl]carbamate (PubChem CID 175583227) has the molecular formula C16H16ClN3O5 and a molecular weight of 365.77 g/mol. Its IUPAC name is tert-butyl N-[4-(2-chloro-4-nitrophenoxy)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-(2-chloro-4-nitrophenoxy)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175583227 |
| Molecular Formula | C16H16ClN3O5 |
| Molecular Weight | 365.77 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | tert-butyl N-[4-(2-chloro-4-nitrophenoxy)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2Cl)ccn1 |
| InChI | InChI=1S/C16H16ClN3O5/c1-16(2,3)25-15(21)19-14-9-11(6-7-18-14)24-13-5-4-10(20(22)23)8-12(13)17/h4-9H,1-3H3,(H,18,19,21) |
| InChIKey | QXFXNBKASHVEAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|