C16H18N4O5 — CID 131735225
tert-butyl N-[4-[(2-methyl-6-nitro-3-pyridinyl)oxy]-2-pyridinyl]carbamate (PubChem CID 131735225) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-methyl-6-nitro-3-pyridinyl)oxy]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-methyl-6-nitro-3-pyridinyl)oxy]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 131735225 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | tert-butyl N-[4-[(2-methyl-6-nitro-3-pyridinyl)oxy]-2-pyridinyl]carbamate |
| SMILES | Cc1nc([N+](=O)[O-])ccc1Oc1ccnc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H18N4O5/c1-10-12(5-6-14(18-10)20(22)23)24-11-7-8-17-13(9-11)19-15(21)25-16(2,3)4/h5-9H,1-4H3,(H,17,19,21) |
| InChIKey | GGVUBBNDEKHFAL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|