C16H11N3O5 — CID 70881346
[4-(4-nitronaphthalen-1-yl)oxy-2-pyridinyl]carbamic acid (PubChem CID 70881346) has the molecular formula C16H11N3O5 and a molecular weight of 325.28 g/mol. Its IUPAC name is [4-(4-nitronaphthalen-1-yl)oxy-2-pyridinyl]carbamic acid.
| Compound Name | [4-(4-nitronaphthalen-1-yl)oxy-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 70881346 |
| Molecular Formula | C16H11N3O5 |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [4-(4-nitronaphthalen-1-yl)oxy-2-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1cc(Oc2ccc([N+](=O)[O-])c3ccccc23)ccn1 |
| InChI | InChI=1S/C16H11N3O5/c20-16(21)18-15-9-10(7-8-17-15)24-14-6-5-13(19(22)23)11-3-1-2-4-12(11)14/h1-9H,(H,17,18)(H,20,21) |
| InChIKey | BGTCOXZHNRFQNL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|