C15H12Cl2N4O6 — CID 121317007
[2-[[4-(2,3-dichloro-4-nitrophenoxy)-2-pyridinyl]amino]-2-oxoethyl]-methylcarbamic acid (PubChem CID 121317007) has the molecular formula C15H12Cl2N4O6 and a molecular weight of 415.19 g/mol. Its IUPAC name is [2-[[4-(2,3-dichloro-4-nitrophenoxy)-2-pyridinyl]amino]-2-oxoethyl]-methylcarbamic acid.
| Compound Name | [2-[[4-(2,3-dichloro-4-nitrophenoxy)-2-pyridinyl]amino]-2-oxoethyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 121317007 |
| Molecular Formula | C15H12Cl2N4O6 |
| Molecular Weight | 415.19 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [2-[[4-(2,3-dichloro-4-nitrophenoxy)-2-pyridinyl]amino]-2-oxoethyl]-methylcarbamic acid |
| SMILES | CN(CC(=O)Nc1cc(Oc2ccc([N+](=O)[O-])c(Cl)c2Cl)ccn1)C(=O)O |
| InChI | InChI=1S/C15H12Cl2N4O6/c1-20(15(23)24)7-12(22)19-11-6-8(4-5-18-11)27-10-3-2-9(21(25)26)13(16)14(10)17/h2-6H,7H2,1H3,(H,23,24)(H,18,19,22) |
| InChIKey | NBODJVHVQAKRPW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|