C15H13Cl2N3O5 — CID 67451741
N-[4-[(2,3-dichloro-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide (PubChem CID 67451741) has the molecular formula C15H13Cl2N3O5 and a molecular weight of 386.19 g/mol. Its IUPAC name is N-[4-[(2,3-dichloro-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide.
| Compound Name | N-[4-[(2,3-dichloro-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 67451741 |
| Molecular Formula | C15H13Cl2N3O5 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | N-[4-[(2,3-dichloro-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1cc(COc2ccc([N+](=O)[O-])c(Cl)c2Cl)ccn1 |
| InChI | InChI=1S/C15H13Cl2N3O5/c1-24-8-13(21)19-12-6-9(4-5-18-12)7-25-11-3-2-10(20(22)23)14(16)15(11)17/h2-6H,7-8H2,1H3,(H,18,19,21) |
| InChIKey | SIJRGBZSVLZVKC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|