C17H19N3O5 — CID 123900698
2-[4-[(2,3-dimethyl-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide (PubChem CID 123900698) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[4-[(2,3-dimethyl-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide.
| Compound Name | 2-[4-[(2,3-dimethyl-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 123900698 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[4-[(2,3-dimethyl-4-nitrophenoxy)methyl]-2-pyridinyl]-2-methoxyacetamide |
| SMILES | COC(C(N)=O)c1cc(COc2ccc([N+](=O)[O-])c(C)c2C)ccn1 |
| InChI | InChI=1S/C17H19N3O5/c1-10-11(2)15(5-4-14(10)20(22)23)25-9-12-6-7-19-13(8-12)16(24-3)17(18)21/h4-8,16H,9H2,1-3H3,(H2,18,21) |
| InChIKey | VGYKABKDNYGZFK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|