C18H23N3O5 — CID 123844996
tert-butyl N-[4-(4-nitrophenoxy)-2-pyridinyl]carbamate;ethane (PubChem CID 123844996) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is tert-butyl N-[4-(4-nitrophenoxy)-2-pyridinyl]carbamate;ethane.
| Compound Name | tert-butyl N-[4-(4-nitrophenoxy)-2-pyridinyl]carbamate;ethane |
|---|---|
| PubChem CID | 123844996 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | tert-butyl N-[4-(4-nitrophenoxy)-2-pyridinyl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2)ccn1 |
| InChI | InChI=1S/C16H17N3O5.C2H6/c1-16(2,3)24-15(20)18-14-10-13(8-9-17-14)23-12-6-4-11(5-7-12)19(21)22;1-2/h4-10H,1-3H3,(H,17,18,20);1-2H3 |
| InChIKey | LNLTYHGWTSOWBU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|