C15H17N5O5 — CID 174638981
tert-butyl N-[[6-(4-nitrophenoxy)pyrimidin-4-yl]amino]carbamate (PubChem CID 174638981) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is tert-butyl N-[[6-(4-nitrophenoxy)pyrimidin-4-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[6-(4-nitrophenoxy)pyrimidin-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 174638981 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl N-[[6-(4-nitrophenoxy)pyrimidin-4-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNc1cc(Oc2ccc([N+](=O)[O-])cc2)ncn1 |
| InChI | InChI=1S/C15H17N5O5/c1-15(2,3)25-14(21)19-18-12-8-13(17-9-16-12)24-11-6-4-10(5-7-11)20(22)23/h4-9H,1-3H3,(H,19,21)(H,16,17,18) |
| InChIKey | LQPNJZAZFCUDTA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|