C13H12FN5O4 — CID 23153022
3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1,1-dimethylurea (PubChem CID 23153022) has the molecular formula C13H12FN5O4 and a molecular weight of 321.27 g/mol. Its IUPAC name is 3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1,1-dimethylurea.
| Compound Name | 3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 23153022 |
| Molecular Formula | C13H12FN5O4 |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2F)ncn1 |
| InChI | InChI=1S/C13H12FN5O4/c1-18(2)13(20)17-11-6-12(16-7-15-11)23-10-4-3-8(19(21)22)5-9(10)14/h3-7H,1-2H3,(H,15,16,17,20) |
| InChIKey | HCERVBLFKCBJJL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|