C16H17FN4O5 — CID 59852957
tert-butyl N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-N-methylcarbamate (PubChem CID 59852957) has the molecular formula C16H17FN4O5 and a molecular weight of 364.33 g/mol. Its IUPAC name is tert-butyl N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 59852957 |
| Molecular Formula | C16H17FN4O5 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | tert-butyl N-[6-(2-fluoro-4-nitrophenoxy)pyrimidin-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1cc(Oc2ccc([N+](=O)[O-])cc2F)ncn1 |
| InChI | InChI=1S/C16H17FN4O5/c1-16(2,3)26-15(22)20(4)13-8-14(19-9-18-13)25-12-6-5-10(21(23)24)7-11(12)17/h5-9H,1-4H3 |
| InChIKey | VYSZTDJNCBXIDU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 107.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|