C23H32FN3O6Si — CID 59853072
tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]carbamate (PubChem CID 59853072) has the molecular formula C23H32FN3O6Si and a molecular weight of 493.61 g/mol. Its IUPAC name is tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 59853072 |
| Molecular Formula | C23H32FN3O6Si |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | tert-butyl N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-fluoro-4-nitrophenoxy)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1nccc(Oc2ccc([N+](=O)[O-])cc2F)c1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H32FN3O6Si/c1-22(2,3)33-21(28)26-20-16(14-31-34(7,8)23(4,5)6)18(11-12-25-20)32-19-10-9-15(27(29)30)13-17(19)24/h9-13H,14H2,1-8H3,(H,25,26,28) |
| InChIKey | WJAPQFFTBJKLKA-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|