C15H11FN4O5 — CID 118197808
methyl N-[4-(2-fluoro-4-nitrophenoxy)pyrazolo[1,5-a]pyridin-6-yl]carbamate (PubChem CID 118197808) has the molecular formula C15H11FN4O5 and a molecular weight of 346.27 g/mol. Its IUPAC name is methyl N-[4-(2-fluoro-4-nitrophenoxy)pyrazolo[1,5-a]pyridin-6-yl]carbamate.
| Compound Name | methyl N-[4-(2-fluoro-4-nitrophenoxy)pyrazolo[1,5-a]pyridin-6-yl]carbamate |
|---|---|
| PubChem CID | 118197808 |
| Molecular Formula | C15H11FN4O5 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | methyl N-[4-(2-fluoro-4-nitrophenoxy)pyrazolo[1,5-a]pyridin-6-yl]carbamate |
| SMILES | COC(=O)Nc1cc(Oc2ccc([N+](=O)[O-])cc2F)c2ccnn2c1 |
| InChI | InChI=1S/C15H11FN4O5/c1-24-15(21)18-9-6-14(12-4-5-17-19(12)8-9)25-13-3-2-10(20(22)23)7-11(13)16/h2-8H,1H3,(H,18,21) |
| InChIKey | OZXRLNADZJXGMV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|