C14H11FN4O4 — CID 21081653
4-(2-fluoro-4-nitrophenoxy)-6-methoxy-5-methylpyrrolo[2,1-f][1,2,4]triazine (PubChem CID 21081653) has the molecular formula C14H11FN4O4 and a molecular weight of 318.26 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenoxy)-6-methoxy-5-methylpyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 4-(2-fluoro-4-nitrophenoxy)-6-methoxy-5-methylpyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 21081653 |
| Molecular Formula | C14H11FN4O4 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenoxy)-6-methoxy-5-methylpyrrolo[2,1-f][1,2,4]triazine |
| SMILES | COc1cn2ncnc(Oc3ccc([N+](=O)[O-])cc3F)c2c1C |
| InChI | InChI=1S/C14H11FN4O4/c1-8-12(22-2)6-18-13(8)14(16-7-17-18)23-11-4-3-9(19(20)21)5-10(11)15/h3-7H,1-2H3 |
| InChIKey | GMCZGWRGTAEYRT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|