C12H6ClFN4O3 — CID 21081699
5-chloro-4-(2-fluoro-4-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 21081699) has the molecular formula C12H6ClFN4O3 and a molecular weight of 308.66 g/mol. Its IUPAC name is 5-chloro-4-(2-fluoro-4-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 5-chloro-4-(2-fluoro-4-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 21081699 |
| Molecular Formula | C12H6ClFN4O3 |
| Molecular Weight | 308.66 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 5-chloro-4-(2-fluoro-4-nitrophenoxy)pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | O=[N+]([O-])c1ccc(Oc2ncnn3ccc(Cl)c23)c(F)c1 |
| InChI | InChI=1S/C12H6ClFN4O3/c13-8-3-4-17-11(8)12(15-6-16-17)21-10-2-1-7(18(19)20)5-9(10)14/h1-6H |
| InChIKey | UYBCJKDCDMZTGT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.66 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|