C8H3ClFN3O3S — CID 54915723
3-chloro-4-(2-fluoro-4-nitrophenoxy)-1,2,5-thiadiazole (PubChem CID 54915723) has the molecular formula C8H3ClFN3O3S and a molecular weight of 275.65 g/mol. Its IUPAC name is 3-chloro-4-(2-fluoro-4-nitrophenoxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(2-fluoro-4-nitrophenoxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 54915723 |
| Molecular Formula | C8H3ClFN3O3S |
| Molecular Weight | 275.65 g/mol |
| Exact Mass | 274.96 |
| IUPAC Name | 3-chloro-4-(2-fluoro-4-nitrophenoxy)-1,2,5-thiadiazole |
| SMILES | O=[N+]([O-])c1ccc(Oc2nsnc2Cl)c(F)c1 |
| InChI | InChI=1S/C8H3ClFN3O3S/c9-7-8(12-17-11-7)16-6-2-1-4(13(14)15)3-5(6)10/h1-3H |
| InChIKey | YLLDWAGHXMOFHK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|