About 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole
3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole (PubChem CID 61038458) has the molecular formula C8H3ClF2N2OS
and a molecular weight of 248.64 g/mol. Its IUPAC name is 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole |
| PubChem CID | 61038458 |
| Molecular Formula | C8H3ClF2N2OS |
| Molecular Weight | 248.64 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole |
| SMILES | Fc1ccc(Oc2nsnc2Cl)c(F)c1 |
| InChI | InChI=1S/C8H3ClF2N2OS/c9-7-8(13-15-12-7)14-6-2-1-4(10)3-5(6)11/h1-3H |
| InChIKey | VBNPNRHGMZINJB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.64 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole?
The IUPAC name of 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole (CID 61038458) is 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole.
What is the SMILES notation for 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole?
The canonical SMILES for 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole is Fc1ccc(Oc2nsnc2Cl)c(F)c1.
What is the InChIKey of 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole?
The InChIKey is VBNPNRHGMZINJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3ClF2N2OS/c9-7-8(13-15-12-7)14-6-2-1-4(10)3-5(6)11/h1-3H.
What are the key properties of 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole?
3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole has a molecular weight of 248.64 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2,4-difluorophenoxy)-1,2,5-thiadiazole is sourced from PubChem (CID 61038458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).