C8H3Cl3N2OS — CID 60726221
3-chloro-4-(2,5-dichlorophenoxy)-1,2,5-thiadiazole (PubChem CID 60726221) has the molecular formula C8H3Cl3N2OS and a molecular weight of 281.55 g/mol. Its IUPAC name is 3-chloro-4-(2,5-dichlorophenoxy)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(2,5-dichlorophenoxy)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 60726221 |
| Molecular Formula | C8H3Cl3N2OS |
| Molecular Weight | 281.55 g/mol |
| Exact Mass | 279.90 |
| IUPAC Name | 3-chloro-4-(2,5-dichlorophenoxy)-1,2,5-thiadiazole |
| SMILES | Clc1ccc(Cl)c(Oc2nsnc2Cl)c1 |
| InChI | InChI=1S/C8H3Cl3N2OS/c9-4-1-2-5(10)6(3-4)14-8-7(11)12-15-13-8/h1-3H |
| InChIKey | WFGFBHVZEUYVLH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |