C12H6ClF2NO3 — CID 107063249
3-chloro-2-(2,4-difluorophenoxy)pyridine-4-carboxylic acid (PubChem CID 107063249) has the molecular formula C12H6ClF2NO3 and a molecular weight of 285.63 g/mol. Its IUPAC name is 3-chloro-2-(2,4-difluorophenoxy)pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-(2,4-difluorophenoxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107063249 |
| Molecular Formula | C12H6ClF2NO3 |
| Molecular Weight | 285.63 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-chloro-2-(2,4-difluorophenoxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(Oc2ccc(F)cc2F)c1Cl |
| InChI | InChI=1S/C12H6ClF2NO3/c13-10-7(12(17)18)3-4-16-11(10)19-9-2-1-6(14)5-8(9)15/h1-5H,(H,17,18) |
| InChIKey | YGNKIWZFTRECAC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |