C14H12ClNO4 — CID 107714129
3-chloro-2-[2-(2-hydroxyethyl)phenoxy]pyridine-4-carboxylic acid (PubChem CID 107714129) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 3-chloro-2-[2-(2-hydroxyethyl)phenoxy]pyridine-4-carboxylic acid.
| Compound Name | 3-chloro-2-[2-(2-hydroxyethyl)phenoxy]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 107714129 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-chloro-2-[2-(2-hydroxyethyl)phenoxy]pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(Oc2ccccc2CCO)c1Cl |
| InChI | InChI=1S/C14H12ClNO4/c15-12-10(14(18)19)5-7-16-13(12)20-11-4-2-1-3-9(11)6-8-17/h1-5,7,17H,6,8H2,(H,18,19) |
| InChIKey | OPPZJXYRPIGLNG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |