C11H6ClFN2O5S — CID 61058240
methyl 4-chloro-2-(2-fluoro-4-nitrophenoxy)-1,3-thiazole-5-carboxylate (PubChem CID 61058240) has the molecular formula C11H6ClFN2O5S and a molecular weight of 332.70 g/mol. Its IUPAC name is methyl 4-chloro-2-(2-fluoro-4-nitrophenoxy)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(2-fluoro-4-nitrophenoxy)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 61058240 |
| Molecular Formula | C11H6ClFN2O5S |
| Molecular Weight | 332.70 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | methyl 4-chloro-2-(2-fluoro-4-nitrophenoxy)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(Oc2ccc([N+](=O)[O-])cc2F)nc1Cl |
| InChI | InChI=1S/C11H6ClFN2O5S/c1-19-10(16)8-9(12)14-11(21-8)20-7-3-2-5(15(17)18)4-6(7)13/h2-4H,1H3 |
| InChIKey | FKPTTYDWAHFPOV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|