C13H9FN4O4 — CID 21081646
4-(2-fluoro-4-nitrophenoxy)-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-ol (PubChem CID 21081646) has the molecular formula C13H9FN4O4 and a molecular weight of 304.24 g/mol. Its IUPAC name is 4-(2-fluoro-4-nitrophenoxy)-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-ol.
| Compound Name | 4-(2-fluoro-4-nitrophenoxy)-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-ol |
|---|---|
| PubChem CID | 21081646 |
| Molecular Formula | C13H9FN4O4 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 4-(2-fluoro-4-nitrophenoxy)-5-methylpyrrolo[2,1-f][1,2,4]triazin-6-ol |
| SMILES | Cc1c(O)cn2ncnc(Oc3ccc([N+](=O)[O-])cc3F)c12 |
| InChI | InChI=1S/C13H9FN4O4/c1-7-10(19)5-17-12(7)13(15-6-16-17)22-11-3-2-8(18(20)21)4-9(11)14/h2-6,19H,1H3 |
| InChIKey | TUIZXCZAIIHRDH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 102.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|