C27H28FN7O5 — CID 11628154
N-[3-fluoro-4-[5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-3-nitrobenzamide (PubChem CID 11628154) has the molecular formula C27H28FN7O5 and a molecular weight of 549.56 g/mol. Its IUPAC name is N-[3-fluoro-4-[5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-fluoro-4-[5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 11628154 |
| Molecular Formula | C27H28FN7O5 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | N-[3-fluoro-4-[5-methyl-6-[2-(4-methylpiperazin-1-yl)ethoxy]pyrrolo[2,1-f][1,2,4]triazin-4-yl]oxyphenyl]-3-nitrobenzamide |
| SMILES | Cc1c(OCCN2CCN(C)CC2)cn2ncnc(Oc3ccc(NC(=O)c4cccc([N+](=O)[O-])c4)cc3F)c12 |
| InChI | InChI=1S/C27H28FN7O5/c1-18-24(39-13-12-33-10-8-32(2)9-11-33)16-34-25(18)27(29-17-30-34)40-23-7-6-20(15-22(23)28)31-26(36)19-4-3-5-21(14-19)35(37)38/h3-7,14-17H,8-13H2,1-2H3,(H,31,36) |
| InChIKey | RFVILQQPFQLDDR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|