C16H16F2N4O5 — CID 155586563
tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-2,3-difluorophenyl]carbamate (PubChem CID 155586563) has the molecular formula C16H16F2N4O5 and a molecular weight of 382.32 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-2,3-difluorophenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-2,3-difluorophenyl]carbamate |
|---|---|
| PubChem CID | 155586563 |
| Molecular Formula | C16H16F2N4O5 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-2,3-difluorophenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ccnc(N)c2[N+](=O)[O-])c(F)c1F |
| InChI | InChI=1S/C16H16F2N4O5/c1-16(2,3)27-15(23)21-8-4-5-9(12(18)11(8)17)26-10-6-7-20-14(19)13(10)22(24)25/h4-7H,1-3H3,(H2,19,20)(H,21,23) |
| InChIKey | VLZYZTVRGYQLSD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|