C29H40FN5O9 — CID 91504380
tert-butyl 2-amino-3-[[4-(2-fluoro-4-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 91504380) has the molecular formula C29H40FN5O9 and a molecular weight of 621.66 g/mol. Its IUPAC name is tert-butyl 2-amino-3-[[4-(2-fluoro-4-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
| Compound Name | tert-butyl 2-amino-3-[[4-(2-fluoro-4-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 91504380 |
| Molecular Formula | C29H40FN5O9 |
| Molecular Weight | 621.66 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | tert-butyl 2-amino-3-[[4-(2-fluoro-4-nitrophenoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyridinyl]methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | CC(C)(C)OC(=O)Nc1nccc(Oc2ccc([N+](=O)[O-])cc2F)c1CN(CC(N)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40FN5O9/c1-27(2,3)42-24(36)20(31)16-34(26(38)44-29(7,8)9)15-18-21(41-22-11-10-17(35(39)40)14-19(22)30)12-13-32-23(18)33-25(37)43-28(4,5)6/h10-14,20H,15-16,31H2,1-9H3,(H,32,33,37) |
| InChIKey | XRZKXYAFIQUSBG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 185.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|