C17H17F3N4O6 — CID 155586386
tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-3-(trifluoromethoxy)phenyl]carbamate (PubChem CID 155586386) has the molecular formula C17H17F3N4O6 and a molecular weight of 430.34 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-3-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-3-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 155586386 |
| Molecular Formula | C17H17F3N4O6 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | tert-butyl N-[4-[(2-amino-3-nitro-4-pyridinyl)oxy]-3-(trifluoromethoxy)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Oc2ccnc(N)c2[N+](=O)[O-])c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F3N4O6/c1-16(2,3)30-15(25)23-9-4-5-10(12(8-9)29-17(18,19)20)28-11-6-7-22-14(21)13(11)24(26)27/h4-8H,1-3H3,(H2,21,22)(H,23,25) |
| InChIKey | IOLUGHWUYKMUDX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 138.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|