C28H26FN3O5S — CID 59684979
tert-butyl N-cyclopropyl-N-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]carbamate (PubChem CID 59684979) has the molecular formula C28H26FN3O5S and a molecular weight of 535.60 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59684979 |
| Molecular Formula | C28H26FN3O5S |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[[4-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(-c2cc3nccc(Oc4ccc([N+](=O)[O-])cc4F)c3s2)cc1)C1CC1 |
| InChI | InChI=1S/C28H26FN3O5S/c1-28(2,3)37-27(33)31(19-8-9-19)16-17-4-6-18(7-5-17)25-15-22-26(38-25)24(12-13-30-22)36-23-11-10-20(32(34)35)14-21(23)29/h4-7,10-15,19H,8-9,16H2,1-3H3 |
| InChIKey | RQHIWQXIQYJVND-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|