C17H15FN4O4S — CID 58790384
7-(2-fluoro-4-nitrophenoxy)-N,N',N'-trimethylthieno[3,2-b]pyridine-2-carbohydrazide (PubChem CID 58790384) has the molecular formula C17H15FN4O4S and a molecular weight of 390.40 g/mol. Its IUPAC name is 7-(2-fluoro-4-nitrophenoxy)-N,N',N'-trimethylthieno[3,2-b]pyridine-2-carbohydrazide.
| Compound Name | 7-(2-fluoro-4-nitrophenoxy)-N,N',N'-trimethylthieno[3,2-b]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 58790384 |
| Molecular Formula | C17H15FN4O4S |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 7-(2-fluoro-4-nitrophenoxy)-N,N',N'-trimethylthieno[3,2-b]pyridine-2-carbohydrazide |
| SMILES | CN(C)N(C)C(=O)c1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2s1 |
| InChI | InChI=1S/C17H15FN4O4S/c1-20(2)21(3)17(23)15-9-12-16(27-15)14(6-7-19-12)26-13-5-4-10(22(24)25)8-11(13)18/h4-9H,1-3H3 |
| InChIKey | GQHCLUYZZMDYAN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|