C18H14FN3O4S — CID 59424552
[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 59424552) has the molecular formula C18H14FN3O4S and a molecular weight of 387.39 g/mol. Its IUPAC name is [7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 59424552 |
| Molecular Formula | C18H14FN3O4S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cc2nccc(Oc3ccc([N+](=O)[O-])cc3F)c2s1)N1CCCC1 |
| InChI | InChI=1S/C18H14FN3O4S/c19-12-9-11(22(24)25)3-4-14(12)26-15-5-6-20-13-10-16(27-17(13)15)18(23)21-7-1-2-8-21/h3-6,9-10H,1-2,7-8H2 |
| InChIKey | OYZOICORPQVKKH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|