C15H11FN2O4S — CID 69341594
2-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]ethanol (PubChem CID 69341594) has the molecular formula C15H11FN2O4S and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]ethanol.
| Compound Name | 2-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 69341594 |
| Molecular Formula | C15H11FN2O4S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-[7-(2-fluoro-4-nitrophenoxy)thieno[3,2-b]pyridin-2-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccnc3cc(CCO)sc23)c(F)c1 |
| InChI | InChI=1S/C15H11FN2O4S/c16-11-7-9(18(20)21)1-2-13(11)22-14-3-5-17-12-8-10(4-6-19)23-15(12)14/h1-3,5,7-8,19H,4,6H2 |
| InChIKey | XYYLCRMZIQOVBD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|