C32H38FN3O5S — CID 58207719
tert-butyl N-[[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]-N-[2-(2-propoxyethoxy)ethyl]carbamate (PubChem CID 58207719) has the molecular formula C32H38FN3O5S and a molecular weight of 595.74 g/mol. Its IUPAC name is tert-butyl N-[[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]-N-[2-(2-propoxyethoxy)ethyl]carbamate.
| Compound Name | tert-butyl N-[[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]-N-[2-(2-propoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 58207719 |
| Molecular Formula | C32H38FN3O5S |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | tert-butyl N-[[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]phenyl]methyl]-N-[2-(2-propoxyethoxy)ethyl]carbamate |
| SMILES | CCCOCCOCCN(Cc1ccc(-c2cc3nccc(Oc4ccc(N)cc4F)c3s2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H38FN3O5S/c1-5-15-38-17-18-39-16-14-36(31(37)41-32(2,3)4)21-22-6-8-23(9-7-22)29-20-26-30(42-29)28(12-13-35-26)40-27-11-10-24(34)19-25(27)33/h6-13,19-20H,5,14-18,21,34H2,1-4H3 |
| InChIKey | BDOJYDVEUGOCLE-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 96.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|