C26H30FN5O4S — CID 140541186
2-methoxyethyl N-[2-[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl]-N-tert-butylcarbamate (PubChem CID 140541186) has the molecular formula C26H30FN5O4S and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-methoxyethyl N-[2-[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl]-N-tert-butylcarbamate.
| Compound Name | 2-methoxyethyl N-[2-[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl]-N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140541186 |
| Molecular Formula | C26H30FN5O4S |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 2-methoxyethyl N-[2-[4-[7-(4-amino-2-fluorophenoxy)thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl]-N-tert-butylcarbamate |
| SMILES | COCCOC(=O)N(CCn1cc(-c2cc3nccc(Oc4ccc(N)cc4F)c3s2)cn1)C(C)(C)C |
| InChI | InChI=1S/C26H30FN5O4S/c1-26(2,3)32(25(33)35-12-11-34-4)10-9-31-16-17(15-30-31)23-14-20-24(37-23)22(7-8-29-20)36-21-6-5-18(28)13-19(21)27/h5-8,13-16H,9-12,28H2,1-4H3 |
| InChIKey | XXZKGOUFYHNSIP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|