C24H19FN4O5S — CID 167263499
2-[4-[7-[2-fluoro-4-[(1-formylcyclopropanecarbonyl)amino]phenoxy]thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl formate (PubChem CID 167263499) has the molecular formula C24H19FN4O5S and a molecular weight of 494.50 g/mol. Its IUPAC name is 2-[4-[7-[2-fluoro-4-[(1-formylcyclopropanecarbonyl)amino]phenoxy]thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl formate.
| Compound Name | 2-[4-[7-[2-fluoro-4-[(1-formylcyclopropanecarbonyl)amino]phenoxy]thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl formate |
|---|---|
| PubChem CID | 167263499 |
| Molecular Formula | C24H19FN4O5S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | 2-[4-[7-[2-fluoro-4-[(1-formylcyclopropanecarbonyl)amino]phenoxy]thieno[3,2-b]pyridin-2-yl]pyrazol-1-yl]ethyl formate |
| SMILES | O=COCCn1cc(-c2cc3nccc(Oc4ccc(NC(=O)C5(C=O)CC5)cc4F)c3s2)cn1 |
| InChI | InChI=1S/C24H19FN4O5S/c25-17-9-16(28-23(32)24(13-30)4-5-24)1-2-19(17)34-20-3-6-26-18-10-21(35-22(18)20)15-11-27-29(12-15)7-8-33-14-31/h1-3,6,9-14H,4-5,7-8H2,(H,28,32) |
| InChIKey | KRLQJVJQJNKVMY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|